cas: 60835-69-0 — see every product listed under this CAS number, including other names
4-Nitrobenzo-15-Crown-5, 98%, 98% (CAS 60835-69-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LV0-250mg |
| cas | 60835-69-0 |
| size | 250mg |
| availability | 22g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 688.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
17-nitro-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene (CAS 60835-69-0) is a chemical compound with the molecular formula C14H19NO7 and a molecular weight of 313.30 g/mol. IUPAC name: 17-nitro-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene. InChIKey: XIWRBQVYCZCEPG-UHFFFAOYSA-N.
| Molecular formula | C14H19NO7 |
|---|---|
| Molecular weight | 313.30 g/mol |
| IUPAC name | 17-nitro-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene |
| InChIKey | XIWRBQVYCZCEPG-UHFFFAOYSA-N |
| SMILES | C1COCCOC2=C(C=C(C=C2)[N+](=O)[O-])OCCOCCO1 |
Computed by PubChem (NCBI)