cas: 60835-69-0 — see every product listed under this CAS number, including other names
4-Nitrobenzo-15-crown-5 99% (CAS 60835-69-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A480372-1g |
| cas | 60835-69-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 248.00 Pln | |
| Ambeed | 5g | 698.56 Pln | |
| Ambeed | 25g | 1983.50 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A480372 |
17-nitro-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene (CAS 60835-69-0) is a chemical compound with the molecular formula C14H19NO7 and a molecular weight of 313.30 g/mol. IUPAC name: 17-nitro-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene. InChIKey: XIWRBQVYCZCEPG-UHFFFAOYSA-N.
| Molecular formula | C14H19NO7 |
|---|---|
| Molecular weight | 313.30 g/mol |
| IUPAC name | 17-nitro-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene |
| InChIKey | XIWRBQVYCZCEPG-UHFFFAOYSA-N |
| SMILES | C1COCCOC2=C(C=C(C=C2)[N+](=O)[O-])OCCOCCO1 |
Computed by PubChem (NCBI)