cas: 60835-69-0 — see every product listed under this CAS number, including other names
(4'-Nitrobenzo)-15-crown-5-Ether, 98% (CAS 60835-69-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F018902-250MG |
| cas | 60835-69-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 232.23 Pln | |
| Fluorochem | 5g | 758.08 Pln | |
| Fluorochem | 25g | 2658.46 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
17-nitro-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene (CAS 60835-69-0) is a chemical compound with the molecular formula C14H19NO7 and a molecular weight of 313.30 g/mol. IUPAC name: 17-nitro-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene. InChIKey: XIWRBQVYCZCEPG-UHFFFAOYSA-N.
| Molecular formula | C14H19NO7 |
|---|---|
| Molecular weight | 313.30 g/mol |
| IUPAC name | 17-nitro-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene |
| InChIKey | XIWRBQVYCZCEPG-UHFFFAOYSA-N |
| SMILES | C1COCCOC2=C(C=C(C=C2)[N+](=O)[O-])OCCOCCO1 |
Computed by PubChem (NCBI)