cas: 60835-69-0 — see every product listed under this CAS number, including other names
4'-Nitrobenzo-15-crown 5-Ether, >99.0%(GC) (CAS 60835-69-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | N0561-1G |
| cas | 60835-69-0 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 437.97 Pln | |
| TCI | 5g | 1672.20 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >99.0%(GC) |
17-nitro-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene (CAS 60835-69-0) is a chemical compound with the molecular formula C14H19NO7 and a molecular weight of 313.30 g/mol. IUPAC name: 17-nitro-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene. InChIKey: XIWRBQVYCZCEPG-UHFFFAOYSA-N.
| Molecular formula | C14H19NO7 |
|---|---|
| Molecular weight | 313.30 g/mol |
| IUPAC name | 17-nitro-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene |
| InChIKey | XIWRBQVYCZCEPG-UHFFFAOYSA-N |
| SMILES | C1COCCOC2=C(C=C(C=C2)[N+](=O)[O-])OCCOCCO1 |
Computed by PubChem (NCBI)