CAS 18600-42-5 appears in our catalog under these names: 4–Nitrobenzylamine Hydrochloride, 4-Nitrobenzylamine hydrochloride, 94% , 4-Nitrobenzylamine Hydrochloride, >98.0%(HPLC)(T), 4-Nitrobenzylamine hydrochloride, 4-NITROBENZYLAMINE HYDROCHLORIDE, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Biosynth, Sigma-Aldrich. Available pack sizes: 25g, 5g, 1g, 50g, 250mg, 10g, 500g, 1kg.
(4-nitrophenyl)methanamine;hydrochloride (CAS 18600-42-5) is a chemical compound with the molecular formula C7H9ClN2O2 and a molecular weight of 188.61 g/mol. IUPAC name: (4-nitrophenyl)methanamine;hydrochloride. InChIKey: SMIXZZMSWYOQPW-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O2 |
|---|---|
| Molecular weight | 188.61 g/mol |
| IUPAC name | (4-nitrophenyl)methanamine;hydrochloride |
| InChIKey | SMIXZZMSWYOQPW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)