4-Nitroindole, 98%, 98%
cas: 4769-97-5 — see every product listed under this CAS number, including other names
4-Nitroindole, 98%, 98% (CAS 4769-97-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11455J-1g |
| cas | 4769-97-5 |
| size | 1g |
| availability | 10000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 155.60 Pln | |
| Chemat | 25g | 290.00 Pln | |
| Chemat | 50g | 510.80 Pln | |
| Chemat | 100g | 942.80 Pln | |
| Chemat | 250g | 2234.00 Pln | |
| Chemat | 500g | 4406.40 Pln | |
| Chemat | 1kg | 6818.00 Pln | |
| Chemat | 5kg | 32587.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-nitro-1H-indole (CAS 4769-97-5) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 4-nitro-1H-indole. InChIKey: LAVZKLJDKGRZJG-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 4-nitro-1H-indole |
| InChIKey | LAVZKLJDKGRZJG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN2)C(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)