CAS 4769-97-5 appears in our catalog under these names: 4-NITROINDOLE, 97%, 4–Nitroindole, 4-Nitroindole, >98.0%(GC), 4-Nitroindole, 4-Nitroindole 98%. Offered by: Sigma-Aldrich, Fluorochem, GLPBio, TCI, Biosynth. Available pack sizes: 1G, 5g, 10g, 25g, 100g, 500g, 50g, 250g.
4-nitro-1H-indole (CAS 4769-97-5) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 4-nitro-1H-indole. InChIKey: LAVZKLJDKGRZJG-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 4-nitro-1H-indole |
| InChIKey | LAVZKLJDKGRZJG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN2)C(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)