cas: 398128-60-4 — see every product listed under this CAS number, including other names
4-Nitrophenyl (E)-3-(4-hydroxy-3-methoxyphenyl)acrylate 98% (CAS 398128-60-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1246474-100mg |
| cas | 398128-60-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 409.31 Pln | |
| Ambeed | 250mg | 620.69 Pln | |
| Ambeed | 1g | 1833.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1246474 |
(4-nitrophenyl) (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (CAS 398128-60-4) is a chemical compound with the molecular formula C16H13NO6 and a molecular weight of 315.28 g/mol. IUPAC name: (4-nitrophenyl) (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate. InChIKey: VIQDYVAKUJDZBD-YCRREMRBSA-N.
| Molecular formula | C16H13NO6 |
|---|---|
| Molecular weight | 315.28 g/mol |
| IUPAC name | (4-nitrophenyl) (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| InChIKey | VIQDYVAKUJDZBD-YCRREMRBSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C/C(=O)OC2=CC=C(C=C2)[N+](=O)[O-])O |
Computed by PubChem (NCBI)