CAS 145370-32-7 is the registry number for Benzoic acid, 3-methoxy-4-nitro-, 2-acetylphenyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2-acetylphenyl) 3-methoxy-4-nitrobenzoate (CAS 145370-32-7) is a chemical compound with the molecular formula C16H13NO6 and a molecular weight of 315.28 g/mol. IUPAC name: (2-acetylphenyl) 3-methoxy-4-nitrobenzoate. InChIKey: GENZJPOSABKOLJ-UHFFFAOYSA-N.
| Molecular formula | C16H13NO6 |
|---|---|
| Molecular weight | 315.28 g/mol |
| IUPAC name | (2-acetylphenyl) 3-methoxy-4-nitrobenzoate |
| InChIKey | GENZJPOSABKOLJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=CC=C1OC(=O)C2=CC(=C(C=C2)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)