Products 145370-32-7

CAS 145370-32-7 is the registry number for Benzoic acid, 3-methoxy-4-nitro-, 2-acetylphenyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

(2-acetylphenyl) 3-methoxy-4-nitrobenzoate (CAS 145370-32-7) is a chemical compound with the molecular formula C16H13NO6 and a molecular weight of 315.28 g/mol. IUPAC name: (2-acetylphenyl) 3-methoxy-4-nitrobenzoate. InChIKey: GENZJPOSABKOLJ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H13NO6
Molecular weight315.28 g/mol
IUPAC name(2-acetylphenyl) 3-methoxy-4-nitrobenzoate
InChIKeyGENZJPOSABKOLJ-UHFFFAOYSA-N
SMILESCC(=O)C1=CC=CC=C1OC(=O)C2=CC(=C(C=C2)[N+](=O)[O-])OC

Computed by PubChem (NCBI)