Products 1820683-62-2
CAS 1820683-62-2 is the registry number for methyl 3-[4-(methoxycarbonyl)phenyl]-5-nitrobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 3-(4-methoxycarbonylphenyl)-5-nitrobenzoate (CAS 1820683-62-2) is a chemical compound with the molecular formula C16H13NO6 and a molecular weight of 315.28 g/mol. IUPAC name: methyl 3-(4-methoxycarbonylphenyl)-5-nitrobenzoate. InChIKey: IGXVZOSCBHZDHZ-UHFFFAOYSA-N.
| Molecular formula | C16H13NO6 |
|---|---|
| Molecular weight | 315.28 g/mol |
| IUPAC name | methyl 3-(4-methoxycarbonylphenyl)-5-nitrobenzoate |
| InChIKey | IGXVZOSCBHZDHZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=CC(=CC(=C2)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)