CAS 398128-60-4 appears in our catalog under these names: 4-Nitrophenyl (E)-3-(4-hydroxy-3-methoxyphenyl)acrylate 98%, 4-Nitrophenyl trans-ferulate, 4-Nitrophenyl (E)-3-(4-hydroxy-3-methoxyphenyl)acrylate, 98%, 98%, 4-Nitrophenyl trans-ferulate, 98%, 4-Nitrophenyl trans-ferulate, 500 mg. Offered by: Ambeed, Biosynth, Chemat, Combi-blocks, Roth. Available pack sizes: 100mg, 250mg, 1g, 50mg, 500mg, 1000mg.
(4-nitrophenyl) (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (CAS 398128-60-4) is a chemical compound with the molecular formula C16H13NO6 and a molecular weight of 315.28 g/mol. IUPAC name: (4-nitrophenyl) (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate. InChIKey: VIQDYVAKUJDZBD-YCRREMRBSA-N.
| Molecular formula | C16H13NO6 |
|---|---|
| Molecular weight | 315.28 g/mol |
| IUPAC name | (4-nitrophenyl) (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| InChIKey | VIQDYVAKUJDZBD-YCRREMRBSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C/C(=O)OC2=CC=C(C=C2)[N+](=O)[O-])O |
Computed by PubChem (NCBI)