cas: 4316-57-8 — see every product listed under this CAS number, including other names
4-Nitrotriphenylamine, 98%, 98% (CAS 4316-57-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DEBF-100mg |
| cas | 4316-57-8 |
| size | 100mg |
| availability | 24g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 587.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-nitro-N,N-diphenylaniline (CAS 4316-57-8) is a chemical compound with the molecular formula C18H14N2O2 and a molecular weight of 290.3 g/mol. IUPAC name: 4-nitro-N,N-diphenylaniline. InChIKey: UQOKZDUUBVGFAK-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O2 |
|---|---|
| Molecular weight | 290.3 g/mol |
| IUPAC name | 4-nitro-N,N-diphenylaniline |
| InChIKey | UQOKZDUUBVGFAK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)