Products 1258196-40-5
CAS 1258196-40-5 is the registry number for 2-Methoxy-4-(9H-pyrido(3,4-b)indol-1-yl)phenol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g.
2-methoxy-4-(9H-pyrido[3,4-b]indol-1-yl)phenol (CAS 1258196-40-5) is a chemical compound with the molecular formula C18H14N2O2 and a molecular weight of 290.3 g/mol. IUPAC name: 2-methoxy-4-(9H-pyrido[3,4-b]indol-1-yl)phenol. InChIKey: VIDRKSNPOZEXKW-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O2 |
|---|---|
| Molecular weight | 290.3 g/mol |
| IUPAC name | 2-methoxy-4-(9H-pyrido[3,4-b]indol-1-yl)phenol |
| InChIKey | VIDRKSNPOZEXKW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C2=NC=CC3=C2NC4=CC=CC=C34)O |
Computed by PubChem (NCBI)