CAS 4316-57-8 appears in our catalog under these names: 4-Nitro-N,N-diphenylaniline, 98%, 4-Nitrotriphenylamine, >98.0%(GC), 4-Nitrotriphenylamine, 98%, 98%, 4-Nitrotriphenylamine, 98%. Offered by: Combi-blocks, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 5g, 1g, 100mg, 250mg.
4-nitro-N,N-diphenylaniline (CAS 4316-57-8) is a chemical compound with the molecular formula C18H14N2O2 and a molecular weight of 290.3 g/mol. IUPAC name: 4-nitro-N,N-diphenylaniline. InChIKey: UQOKZDUUBVGFAK-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O2 |
|---|---|
| Molecular weight | 290.3 g/mol |
| IUPAC name | 4-nitro-N,N-diphenylaniline |
| InChIKey | UQOKZDUUBVGFAK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)