CAS 15741-71-6 is the registry number for 2-[2-(1H-Indol-3-yl)ethyl]isoindole-1,3-dione, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-[2-(1H-indol-3-yl)ethyl]isoindole-1,3-dione (CAS 15741-71-6) is a chemical compound with the molecular formula C18H14N2O2 and a molecular weight of 290.3 g/mol. IUPAC name: 2-[2-(1H-indol-3-yl)ethyl]isoindole-1,3-dione. InChIKey: SAQDVULJSRMFJO-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O2 |
|---|---|
| Molecular weight | 290.3 g/mol |
| IUPAC name | 2-[2-(1H-indol-3-yl)ethyl]isoindole-1,3-dione |
| InChIKey | SAQDVULJSRMFJO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCC3=CNC4=CC=CC=C43 |
Computed by PubChem (NCBI)