cas: 119736-16-2 — see every product listed under this CAS number, including other names
4-Oxo-3-(phenylmethoxy)-4H-pyran-2-carboxylic acid, 98%, 98% (CAS 119736-16-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111PKF-1g |
| cas | 119736-16-2 |
| size | 1g |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 136.40 Pln | |
| Chemat | 50g | 208.40 Pln | |
| Chemat | 100g | 338.00 Pln | |
| Chemat | 250g | 731.60 Pln | |
| Chemat | 500g | 1440.00 Pln | |
| Chemat | 1kg | 2622.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-oxo-3-phenylmethoxypyran-2-carboxylic acid (CAS 119736-16-2) is a chemical compound with the molecular formula C13H10O5 and a molecular weight of 246.21 g/mol. IUPAC name: 4-oxo-3-phenylmethoxypyran-2-carboxylic acid. InChIKey: KJSJBKBZMGSIPT-UHFFFAOYSA-N.
| Molecular formula | C13H10O5 |
|---|---|
| Molecular weight | 246.21 g/mol |
| IUPAC name | 4-oxo-3-phenylmethoxypyran-2-carboxylic acid |
| InChIKey | KJSJBKBZMGSIPT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(OC=CC2=O)C(=O)O |
Computed by PubChem (NCBI)