Products 119736-16-2
CAS 119736-16-2 appears in our catalog under these names: Baloxavir Marboxil Impurity 2, 3–(Benzyloxy)–4–oxo–4H–pyran–2–carboxylic acid, 3-(Benzyloxy)-4-oxo-4H-pyran-2-carboxylic acid 95%, 4-Oxo-3-(phenylmethoxy)-4H-pyran-2-carboxylic acid, 98%, 98%, 3-(BENZYLOXY)-4-OXO-4H-PYRAN-2-CARBOXYLIC ACID, 98%. Offered by: Chemat Brand, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 100g, 10g, 25g, 1000g, 1g, 5g, 500g.
4-oxo-3-phenylmethoxypyran-2-carboxylic acid (CAS 119736-16-2) is a chemical compound with the molecular formula C13H10O5 and a molecular weight of 246.21 g/mol. IUPAC name: 4-oxo-3-phenylmethoxypyran-2-carboxylic acid. InChIKey: KJSJBKBZMGSIPT-UHFFFAOYSA-N.
| Molecular formula | C13H10O5 |
|---|---|
| Molecular weight | 246.21 g/mol |
| IUPAC name | 4-oxo-3-phenylmethoxypyran-2-carboxylic acid |
| InChIKey | KJSJBKBZMGSIPT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(OC=CC2=O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(benzyloxy)-4-oxo-4h-pyran-2-carboxylic acid, 4H-Pyran-2-carboxylic acid, 4-oxo-3-(phenylmethoxy)-, 4-oxo-3-phenylmethoxypyran-2-carboxylic acid, 4-Oxo-3-(phenylmethoxy)-4H-pyran-2-carboxylic acid, 4-oxo-3-[(phenylmethyl)oxy]-4h-pyran-2-carboxylic acid, 3-benzyloxy-4-oxo-4H-pyran-2-carboxylic acid, BPCA, Baloxavir Impurity 30, 4-oxo-3-((phenylmethyl)oxy)-4h-pyran-2-carboxylic acid, Baloxavir Marboxil Impurity 2