CAS 1155071-75-2 is the registry number for 2-(3-Formylphenoxymethyl)furan-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2-[(3-formylphenoxy)methyl]furan-3-carboxylic acid (CAS 1155071-75-2) is a chemical compound with the molecular formula C13H10O5 and a molecular weight of 246.21 g/mol. IUPAC name: 2-[(3-formylphenoxy)methyl]furan-3-carboxylic acid. InChIKey: BWMVXNOPPLVQCY-UHFFFAOYSA-N.
| Molecular formula | C13H10O5 |
|---|---|
| Molecular weight | 246.21 g/mol |
| IUPAC name | 2-[(3-formylphenoxy)methyl]furan-3-carboxylic acid |
| InChIKey | BWMVXNOPPLVQCY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC2=C(C=CO2)C(=O)O)C=O |
Computed by PubChem (NCBI)