CAS 1219-33-6 appears in our catalog under these names: 5–(Benzyloxy)–4–oxo–4H–pyran–2–carboxylic acid, 5-(Benzyloxy)-4-oxo-4H-pyran-2-carboxylic acid 96%, 5-(Benzyloxy)-4-oxo-4H-pyran-2-carboxylic acid, 96%, 96%, 5-(Benzyloxy)-4-oxo-4H-pyran-2-carboxylic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
4-oxo-5-phenylmethoxypyran-2-carboxylic acid (CAS 1219-33-6) is a chemical compound with the molecular formula C13H10O5 and a molecular weight of 246.21 g/mol. IUPAC name: 4-oxo-5-phenylmethoxypyran-2-carboxylic acid. InChIKey: RGZZNPNSZZJJSH-UHFFFAOYSA-N.
| Molecular formula | C13H10O5 |
|---|---|
| Molecular weight | 246.21 g/mol |
| IUPAC name | 4-oxo-5-phenylmethoxypyran-2-carboxylic acid |
| InChIKey | RGZZNPNSZZJJSH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=COC(=CC2=O)C(=O)O |
Computed by PubChem (NCBI)