cas: 459157-20-1 — see every product listed under this CAS number, including other names
4-Oxo-4,5,6,7-tetrahydro-pyrazolo[1,5-a]pyridine-2-carboxylic acid, 98% (CAS 459157-20-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F317673-100MG |
| cas | 459157-20-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 351.98 Pln | |
| Fluorochem | 250mg | 565.44 Pln | |
| Fluorochem | 1g | 1309.97 Pln | |
| Fluorochem | 5g | 4996.18 Pln | |
| Fluorochem | 10g | 9937.14 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-oxo-6,7-dihydro-5H-pyrazolo[1,5-a]pyridine-2-carboxylic acid (CAS 459157-20-1) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: 4-oxo-6,7-dihydro-5H-pyrazolo[1,5-a]pyridine-2-carboxylic acid. InChIKey: BTXPQDNIJCRMTQ-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 4-oxo-6,7-dihydro-5H-pyrazolo[1,5-a]pyridine-2-carboxylic acid |
| InChIKey | BTXPQDNIJCRMTQ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=CC(=NN2C1)C(=O)O |
Computed by PubChem (NCBI)