cas: 459157-20-1 — see every product listed under this CAS number, including other names
4-Oxo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-2-carboxylic acid, 98%, 98% (CAS 459157-20-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E7JH-100mg |
| cas | 459157-20-1 |
| size | 100mg |
| availability | 35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 453.20 Pln | |
| Chemat | 1g | 1134.80 Pln | |
| Chemat | 5g | 3424.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-oxo-6,7-dihydro-5H-pyrazolo[1,5-a]pyridine-2-carboxylic acid (CAS 459157-20-1) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: 4-oxo-6,7-dihydro-5H-pyrazolo[1,5-a]pyridine-2-carboxylic acid. InChIKey: BTXPQDNIJCRMTQ-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 4-oxo-6,7-dihydro-5H-pyrazolo[1,5-a]pyridine-2-carboxylic acid |
| InChIKey | BTXPQDNIJCRMTQ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=CC(=NN2C1)C(=O)O |
Computed by PubChem (NCBI)