cas: 1030269-28-3 — see every product listed under this CAS number, including other names
4-Oxo-4-((3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)amino)butanoic acid 96% (CAS 1030269-28-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A708301-250mg |
| cas | 1030269-28-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 248.00 Pln | |
| Ambeed | 5g | 642.94 Pln | |
| Ambeed | 25g | 2072.50 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A708301 |
4-oxo-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]butanoic acid (CAS 1030269-28-3) is a chemical compound with the molecular formula C16H22BNO5 and a molecular weight of 319.2 g/mol. IUPAC name: 4-oxo-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]butanoic acid. InChIKey: IOFRLFIFTQTDDV-UHFFFAOYSA-N.
| Molecular formula | C16H22BNO5 |
|---|---|
| Molecular weight | 319.2 g/mol |
| IUPAC name | 4-oxo-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]butanoic acid |
| InChIKey | IOFRLFIFTQTDDV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)