cas: 1030269-28-3 — see every product listed under this CAS number, including other names
4-Oxo-4-((3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)amino)butanoic acid, 96% (CAS 1030269-28-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F218493-250MG |
| cas | 1030269-28-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 315.53 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
4-oxo-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]butanoic acid (CAS 1030269-28-3) is a chemical compound with the molecular formula C16H22BNO5 and a molecular weight of 319.2 g/mol. IUPAC name: 4-oxo-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]butanoic acid. InChIKey: IOFRLFIFTQTDDV-UHFFFAOYSA-N.
| Molecular formula | C16H22BNO5 |
|---|---|
| Molecular weight | 319.2 g/mol |
| IUPAC name | 4-oxo-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]butanoic acid |
| InChIKey | IOFRLFIFTQTDDV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)