cas: 379254-26-9 — see every product listed under this CAS number, including other names
4-P-Tolylsulfamoyl-benzoic acid, 97%, 97% (CAS 379254-26-9) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I8GR-5g |
| cas | 379254-26-9 |
| size | 5g |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 885.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-[(4-methylphenyl)sulfamoyl]benzoic acid (CAS 379254-26-9) is a chemical compound with the molecular formula C14H13NO4S and a molecular weight of 291.32 g/mol. IUPAC name: 4-[(4-methylphenyl)sulfamoyl]benzoic acid. InChIKey: NWOOPPFGYBXGHY-UHFFFAOYSA-N.
| Molecular formula | C14H13NO4S |
|---|---|
| Molecular weight | 291.32 g/mol |
| IUPAC name | 4-[(4-methylphenyl)sulfamoyl]benzoic acid |
| InChIKey | NWOOPPFGYBXGHY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)