Products 519153-07-2
CAS 519153-07-2 appears in our catalog under these names: 4-((2-Methylphenyl)sulfamoyl)benzoic acid, 95%, 4-O-Tolylsulfamoyl-benzoic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g, 100mg.
4-[(2-methylphenyl)sulfamoyl]benzoic acid (CAS 519153-07-2) is a chemical compound with the molecular formula C14H13NO4S and a molecular weight of 291.32 g/mol. IUPAC name: 4-[(2-methylphenyl)sulfamoyl]benzoic acid. InChIKey: VPMPYAXGUXACTQ-UHFFFAOYSA-N.
| Molecular formula | C14H13NO4S |
|---|---|
| Molecular weight | 291.32 g/mol |
| IUPAC name | 4-[(2-methylphenyl)sulfamoyl]benzoic acid |
| InChIKey | VPMPYAXGUXACTQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1NS(=O)(=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)