CAS 379254-26-9 appears in our catalog under these names: 4-P-Tolylsulfamoyl-benzoic acid, 96%, 4-P-Tolylsulfamoyl-benzoic acid, 97%, 97%, 4-{[(4-methylphenyl)amino]sulfonyl}benzoic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g.
4-[(4-methylphenyl)sulfamoyl]benzoic acid (CAS 379254-26-9) is a chemical compound with the molecular formula C14H13NO4S and a molecular weight of 291.32 g/mol. IUPAC name: 4-[(4-methylphenyl)sulfamoyl]benzoic acid. InChIKey: NWOOPPFGYBXGHY-UHFFFAOYSA-N.
| Molecular formula | C14H13NO4S |
|---|---|
| Molecular weight | 291.32 g/mol |
| IUPAC name | 4-[(4-methylphenyl)sulfamoyl]benzoic acid |
| InChIKey | NWOOPPFGYBXGHY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)