Products 54838-78-7
CAS 54838-78-7 appears in our catalog under these names: 4-(Methyl-phenyl-sulfamoyl)-benzoic acid, 95%, 4-(Methyl(phenyl)sulfamoyl)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
4-[methyl(phenyl)sulfamoyl]benzoic acid (CAS 54838-78-7) is a chemical compound with the molecular formula C14H13NO4S and a molecular weight of 291.32 g/mol. IUPAC name: 4-[methyl(phenyl)sulfamoyl]benzoic acid. InChIKey: USOAJBIMCUIRFH-UHFFFAOYSA-N.
| Molecular formula | C14H13NO4S |
|---|---|
| Molecular weight | 291.32 g/mol |
| IUPAC name | 4-[methyl(phenyl)sulfamoyl]benzoic acid |
| InChIKey | USOAJBIMCUIRFH-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=CC=C1)S(=O)(=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)