4-Phenoxybenzene-1-sulfonyl chloride, 96%
cas: 1623-92-3 — see every product listed under this CAS number, including other names
4-Phenoxybenzene-1-sulfonyl chloride, 96% (CAS 1623-92-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A808569-250mg |
| cas | 1623-92-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 442.69 Pln | |
| Ambeed | 5g | 1110.19 Pln | |
| Ambeed | 10g | 1900.06 Pln | |
| Ambeed | 25g | 3724.56 Pln | |
| BLDpharm | 250mg | 203.29 Pln | |
| BLDpharm | 1g | 469.86 Pln | |
| BLDpharm | 5g | 1191.83 Pln | |
| BLDpharm | 10g | 2041.53 Pln | |
| BLDpharm | 25g | 4013.06 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
4-phenoxybenzenesulfonyl chloride (CAS 1623-92-3) is a chemical compound with the molecular formula C12H9ClO3S and a molecular weight of 268.72 g/mol. IUPAC name: 4-phenoxybenzenesulfonyl chloride. InChIKey: QIZPONOMFWAPRR-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO3S |
|---|---|
| Molecular weight | 268.72 g/mol |
| IUPAC name | 4-phenoxybenzenesulfonyl chloride |
| InChIKey | QIZPONOMFWAPRR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
4-phenoxybenzene-1-sulfonyl chloride, 4-phenoxybenzenesulfonyl Chloride, Benzenesulfonyl chloride, 4-phenoxy-, 4-Phenoxybenzenesulphonyl chloride, 4-Phenoxy-benzenesulfonyl chloride, [(4-phenoxy)benzene]sulfonyl chloride, [(4-phenoxy)benzene]sulphonyl chloride, chloro(4-phenoxyphenyl)sulfone, 4-phenoxyphenylsulfonyl chloride, 4-Phenoxybenzene-sulfonyl chlori