CAS 74556-81-3 is the registry number for 5-(3-Chlorophenoxymethyl)thiophene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
5-[(3-chlorophenoxy)methyl]thiophene-2-carboxylic acid (CAS 74556-81-3) is a chemical compound with the molecular formula C12H9ClO3S and a molecular weight of 268.72 g/mol. IUPAC name: 5-[(3-chlorophenoxy)methyl]thiophene-2-carboxylic acid. InChIKey: QIRNDRHHPZXSCN-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO3S |
|---|---|
| Molecular weight | 268.72 g/mol |
| IUPAC name | 5-[(3-chlorophenoxy)methyl]thiophene-2-carboxylic acid |
| InChIKey | QIRNDRHHPZXSCN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)OCC2=CC=C(S2)C(=O)O |
Computed by PubChem (NCBI)