Products 74556-81-3

CAS 74556-81-3 is the registry number for 5-(3-Chlorophenoxymethyl)thiophene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

5-[(3-chlorophenoxy)methyl]thiophene-2-carboxylic acid (CAS 74556-81-3) is a chemical compound with the molecular formula C12H9ClO3S and a molecular weight of 268.72 g/mol. IUPAC name: 5-[(3-chlorophenoxy)methyl]thiophene-2-carboxylic acid. InChIKey: QIRNDRHHPZXSCN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9ClO3S
Molecular weight268.72 g/mol
IUPAC name5-[(3-chlorophenoxy)methyl]thiophene-2-carboxylic acid
InChIKeyQIRNDRHHPZXSCN-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)Cl)OCC2=CC=C(S2)C(=O)O

Computed by PubChem (NCBI)