Products 2688-85-9
CAS 2688-85-9 appears in our catalog under these names: 2–Phenoxybenzene sulfonyl chloride, 2-Phenoxybenzene sulfonyl chloride, 95%, 95%, 2-PHENOXYBENZENE SULFONYL CHLORIDE, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
2-phenoxybenzenesulfonyl chloride (CAS 2688-85-9) is a chemical compound with the molecular formula C12H9ClO3S and a molecular weight of 268.72 g/mol. IUPAC name: 2-phenoxybenzenesulfonyl chloride. InChIKey: MFBATEXBHGBONO-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO3S |
|---|---|
| Molecular weight | 268.72 g/mol |
| IUPAC name | 2-phenoxybenzenesulfonyl chloride |
| InChIKey | MFBATEXBHGBONO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2S(=O)(=O)Cl |
Computed by PubChem (NCBI)