CAS 1511303-44-8 is the registry number for 4-((2-Chlorobenzyl)oxy)thiophene-2-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-[(2-chlorophenyl)methoxy]thiophene-2-carboxylic acid (CAS 1511303-44-8) is a chemical compound with the molecular formula C12H9ClO3S and a molecular weight of 268.72 g/mol. IUPAC name: 4-[(2-chlorophenyl)methoxy]thiophene-2-carboxylic acid. InChIKey: JHEIQWNGMNCUPP-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO3S |
|---|---|
| Molecular weight | 268.72 g/mol |
| IUPAC name | 4-[(2-chlorophenyl)methoxy]thiophene-2-carboxylic acid |
| InChIKey | JHEIQWNGMNCUPP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC2=CSC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)