cas: 5004-94-4 — see every product listed under this CAS number, including other names
4-Phenylpiperidin-4-ol hydrochloride 95% (CAS 5004-94-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A690932-250mg |
| cas | 5004-94-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 693.00 Pln | |
| Ambeed | 10g | 1071.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A690932 |
4-phenylpiperidin-4-ol;hydrochloride (CAS 5004-94-4) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 4-phenylpiperidin-4-ol;hydrochloride. InChIKey: SETKGOFWOWUIIE-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | 4-phenylpiperidin-4-ol;hydrochloride |
| InChIKey | SETKGOFWOWUIIE-UHFFFAOYSA-N |
| SMILES | C1CNCCC1(C2=CC=CC=C2)O.Cl |
Computed by PubChem (NCBI)