cas: 14149-31-6 — see every product listed under this CAS number, including other names
4-Phenylpiperidine-2,6-dione, 95+% (CAS 14149-31-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A935745-5g |
| cas | 14149-31-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 17419.15 Pln | |
| AmBeed | 10g | 24866.59 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-phenylpiperidine-2,6-dione (CAS 14149-31-6) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 4-phenylpiperidine-2,6-dione. InChIKey: LIEGIQPEUGHGAI-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 4-phenylpiperidine-2,6-dione |
| InChIKey | LIEGIQPEUGHGAI-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)NC1=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)