cas: 206556-00-5 — see every product listed under this CAS number, including other names
4-Phenylthiazole-5-carbaldehyde 95% (CAS 206556-00-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A404054-50mg |
| cas | 206556-00-5 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 459.38 Pln | |
| Ambeed | 100mg | 726.38 Pln | |
| Ambeed | 250mg | 1243.69 Pln | |
| Ambeed | 1g | 3001.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A404054 |
4-phenyl-1,3-thiazole-5-carbaldehyde (CAS 206556-00-5) is a chemical compound with the molecular formula C10H7NOS and a molecular weight of 189.24 g/mol. IUPAC name: 4-phenyl-1,3-thiazole-5-carbaldehyde. InChIKey: ZCFVPBKIUPRFQR-UHFFFAOYSA-N.
| Molecular formula | C10H7NOS |
|---|---|
| Molecular weight | 189.24 g/mol |
| IUPAC name | 4-phenyl-1,3-thiazole-5-carbaldehyde |
| InChIKey | ZCFVPBKIUPRFQR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(SC=N2)C=O |
Computed by PubChem (NCBI)