cas: 17688-68-5 — see every product listed under this CAS number, including other names
4-Phenylthiomorpholine 1,1-Dioxide, >98.0%(GC) (CAS 17688-68-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | P1603-5G |
| cas | 17688-68-5 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 413.38 Pln | |
| TCI | 25g | 1268.98 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
4-phenyl-1,4-thiazinane 1,1-dioxide (CAS 17688-68-5) is a chemical compound with the molecular formula C10H13NO2S and a molecular weight of 211.28 g/mol. IUPAC name: 4-phenyl-1,4-thiazinane 1,1-dioxide. InChIKey: OLQHDKQJHKZUNN-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2S |
|---|---|
| Molecular weight | 211.28 g/mol |
| IUPAC name | 4-phenyl-1,4-thiazinane 1,1-dioxide |
| InChIKey | OLQHDKQJHKZUNN-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1C2=CC=CC=C2 |
Computed by PubChem (NCBI)