cas: 880166-18-7 — see every product listed under this CAS number, including other names
4-Thien-2-yltetrahydropyran-4-carboxylic acid, 97% (CAS 880166-18-7) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC62201CB |
| cas | 880166-18-7 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 411.85 Pln | |
| Thermo Scientific | 1g | 1114.89 Pln | |
| Thermo Scientific | 5g | 3578.83 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
4-thiophen-2-yloxane-4-carboxylic acid (CAS 880166-18-7) is a chemical compound with the molecular formula C10H12O3S and a molecular weight of 212.27 g/mol. IUPAC name: 4-thiophen-2-yloxane-4-carboxylic acid. InChIKey: VWYOZQWRYINSBP-UHFFFAOYSA-N.
| Molecular formula | C10H12O3S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | 4-thiophen-2-yloxane-4-carboxylic acid |
| InChIKey | VWYOZQWRYINSBP-UHFFFAOYSA-N |
| SMILES | C1COCCC1(C2=CC=CS2)C(=O)O |
Computed by PubChem (NCBI)