Products 75732-43-3
CAS 75732-43-3 is the registry number for 3-Benzyl-[1,2]oxathiolane 2,2-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 25g, 10g, 5g.
3-benzyloxathiolane 2,2-dioxide (CAS 75732-43-3) is a chemical compound with the molecular formula C10H12O3S and a molecular weight of 212.27 g/mol. IUPAC name: 3-benzyloxathiolane 2,2-dioxide. InChIKey: YMDYPJRCONIRKH-UHFFFAOYSA-N.
| Molecular formula | C10H12O3S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | 3-benzyloxathiolane 2,2-dioxide |
| InChIKey | YMDYPJRCONIRKH-UHFFFAOYSA-N |
| SMILES | C1COS(=O)(=O)C1CC2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
3-benzyl-1,2-oxathiolane 2,2-dioxide, 3-benzyloxathiolane 2,2-dioxide, 3-benzyl-[1,2]oxathiolane 2,2-dioxide, 3-Benzyl-12-oxathiolane 22-dioxide, 3-benzyl-1,2-oxathiolane-2,2-dione, 3-benzyl-1,2-oxathiolane2,2-dioxide, 3-benzyl-1,2lambda-oxathiolane-2,2-dione, 3-Benzyl-1,2-oxathiolane 2,2-dioxide, 95%, 3-Benzyl-1,2lambda~6~-oxathiolane-2,2-dione