CAS 93-12-9 appears in our catalog under these names: 5,6,7,8-Tetrahydronaphthalene-2-sulfonic acid, 96%, 5,6,7,8–Tetrahydronaphthalene–2–sulfonic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 1g, 250mg, 100g.
5,6,7,8-tetrahydronaphthalene-2-sulfonic acid (CAS 93-12-9) is a chemical compound with the molecular formula C10H12O3S and a molecular weight of 212.27 g/mol. IUPAC name: 5,6,7,8-tetrahydronaphthalene-2-sulfonic acid. InChIKey: CTEWUQNEQPLMMJ-UHFFFAOYSA-N.
| Molecular formula | C10H12O3S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | 5,6,7,8-tetrahydronaphthalene-2-sulfonic acid |
| InChIKey | CTEWUQNEQPLMMJ-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=CC(=C2)S(=O)(=O)O |
Computed by PubChem (NCBI)