CAS 880166-18-7 appears in our catalog under these names: 4-(Thien-2-yl)tetrahydropyran-4-carboxylic acid, 95%, 4-(Thiophen-2-yl)tetrahydro-2H-pyran-4-carboxylic acid, 95%, 4-Thien-2-yltetrahydro-2H-pyran-4-carboxylic acid, 4-Thien-2-yltetrahydropyran-4-carboxylic acid, 97% , 4-(Thiophen-2-Yl)Tetrahydro-2H-Pyran-4-Carboxylic Acid, 99.81% ,, 99.81% ,. Offered by: Combi-blocks, AmBeed, Biosynth, Thermo Scientific, Chemat. Available pack sizes: 250mg, 5g, 10g, 1g, 100mg, 2,5g, 5mg, 25mg.
4-thiophen-2-yloxane-4-carboxylic acid (CAS 880166-18-7) is a chemical compound with the molecular formula C10H12O3S and a molecular weight of 212.27 g/mol. IUPAC name: 4-thiophen-2-yloxane-4-carboxylic acid. InChIKey: VWYOZQWRYINSBP-UHFFFAOYSA-N.
| Molecular formula | C10H12O3S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | 4-thiophen-2-yloxane-4-carboxylic acid |
| InChIKey | VWYOZQWRYINSBP-UHFFFAOYSA-N |
| SMILES | C1COCCC1(C2=CC=CS2)C(=O)O |
Computed by PubChem (NCBI)