cas: 102422-55-9 — see every product listed under this CAS number, including other names
4-Trifluoromethylbenzylisocyanate, 95%, 95% (CAS 102422-55-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1118G6-100mg |
| cas | 102422-55-9 |
| size | 100mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 189.20 Pln | |
| Chemat | 10g | 275.60 Pln | |
| Chemat | 25g | 486.80 Pln | |
| Chemat | 100g | 1600.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(isocyanatomethyl)-4-(trifluoromethyl)benzene (CAS 102422-55-9) is a chemical compound with the molecular formula C9H6F3NO and a molecular weight of 201.14 g/mol. IUPAC name: 1-(isocyanatomethyl)-4-(trifluoromethyl)benzene. InChIKey: MBBQXHDBRSSIKS-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO |
|---|---|
| Molecular weight | 201.14 g/mol |
| IUPAC name | 1-(isocyanatomethyl)-4-(trifluoromethyl)benzene |
| InChIKey | MBBQXHDBRSSIKS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN=C=O)C(F)(F)F |
Computed by PubChem (NCBI)