cas: 49763-65-7 — see every product listed under this CAS number, including other names
4-pentylbenzoyl chloride (CAS 49763-65-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F245762-250MG |
| cas | 49763-65-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 825.77 Pln | |
| Fluorochem | 25g | 2746.97 Pln |
| delivery time | 3-4 weeks |
|---|
4-pentylbenzoyl chloride (CAS 49763-65-7) is a chemical compound with the molecular formula C12H15ClO and a molecular weight of 210.70 g/mol. IUPAC name: 4-pentylbenzoyl chloride. InChIKey: FBBRKYLXMNQFQU-UHFFFAOYSA-N.
| Molecular formula | C12H15ClO |
|---|---|
| Molecular weight | 210.70 g/mol |
| IUPAC name | 4-pentylbenzoyl chloride |
| InChIKey | FBBRKYLXMNQFQU-UHFFFAOYSA-N |
| SMILES | CCCCCC1=CC=C(C=C1)C(=O)Cl |
Computed by PubChem (NCBI)