CAS 412013-51-5 is the registry number for 1-[3-(Chloromethyl)-2,4,6-trimethylphenyl]ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-[3-(chloromethyl)-2,4,6-trimethylphenyl]ethanone (CAS 412013-51-5) is a chemical compound with the molecular formula C12H15ClO and a molecular weight of 210.70 g/mol. IUPAC name: 1-[3-(chloromethyl)-2,4,6-trimethylphenyl]ethanone. InChIKey: IDTSHTPFUYLXGB-UHFFFAOYSA-N.
| Molecular formula | C12H15ClO |
|---|---|
| Molecular weight | 210.70 g/mol |
| IUPAC name | 1-[3-(chloromethyl)-2,4,6-trimethylphenyl]ethanone |
| InChIKey | IDTSHTPFUYLXGB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1CCl)C)C(=O)C)C |
Computed by PubChem (NCBI)