CAS 21886-62-4 appears in our catalog under these names: 4-tert-Butylphenacyl chloride, 97%, 1-(4-tert-Butylphenyl)-2-chloroethanone, 1-(4-(tert-Butyl)phenyl)-2-chloroethanone 97%, 1-(4-(tert-butyl)phenyl)-2-chloro-1-ethanone. Offered by: Combi-blocks, Fluorochem, Ambeed, Biosynth. Available pack sizes: 5g, 1g, 25g, 250mg, 500mg, 1000mg.
1-(4-tert-butylphenyl)-2-chloroethanone (CAS 21886-62-4) is a chemical compound with the molecular formula C12H15ClO and a molecular weight of 210.70 g/mol. IUPAC name: 1-(4-tert-butylphenyl)-2-chloroethanone. InChIKey: LTHPBRNHHJIQME-UHFFFAOYSA-N.
| Molecular formula | C12H15ClO |
|---|---|
| Molecular weight | 210.70 g/mol |
| IUPAC name | 1-(4-tert-butylphenyl)-2-chloroethanone |
| InChIKey | LTHPBRNHHJIQME-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)CCl |
Computed by PubChem (NCBI)