CAS 571155-28-7 is the registry number for 2-Chloro-1-(2,4,5-trimethylphenyl)propan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-chloro-1-(2,4,5-trimethylphenyl)propan-1-one (CAS 571155-28-7) is a chemical compound with the molecular formula C12H15ClO and a molecular weight of 210.70 g/mol. IUPAC name: 2-chloro-1-(2,4,5-trimethylphenyl)propan-1-one. InChIKey: OSAHTYSEKMOORS-UHFFFAOYSA-N.
| Molecular formula | C12H15ClO |
|---|---|
| Molecular weight | 210.70 g/mol |
| IUPAC name | 2-chloro-1-(2,4,5-trimethylphenyl)propan-1-one |
| InChIKey | OSAHTYSEKMOORS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)C(=O)C(C)Cl)C |
Computed by PubChem (NCBI)