cas: 50342-17-1 — see every product listed under this CAS number, including other names
5'-Bromo-2'-hydroxy-4'-methylacetophenone, 98% (CAS 50342-17-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F494247-1G |
| cas | 50342-17-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 200.99 Pln | |
| Fluorochem | 5g | 758.08 Pln | |
| Fluorochem | 10g | 1466.17 Pln | |
| Fluorochem | 25g | 3580.01 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-bromo-2-hydroxy-5-methylphenyl)ethanone (CAS 50342-17-1) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 1-(4-bromo-2-hydroxy-5-methylphenyl)ethanone. InChIKey: BPQABGQSVOUODJ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 1-(4-bromo-2-hydroxy-5-methylphenyl)ethanone |
| InChIKey | BPQABGQSVOUODJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)O)C(=O)C |
Computed by PubChem (NCBI)