cas: 239075-02-6 — see every product listed under this CAS number, including other names
5,5'-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,2'-bithiophene 98% (CAS 239075-02-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A686319-100mg |
| cas | 239075-02-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 698.56 Pln | |
| Ambeed | 25g | 2489.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A686319 |
4,4,5,5-tetramethyl-2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]thiophen-2-yl]-1,3,2-dioxaborolane (CAS 239075-02-6) is a chemical compound with the molecular formula C20H28B2O4S2 and a molecular weight of 418.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]thiophen-2-yl]-1,3,2-dioxaborolane. InChIKey: XWWXVHGWYCXJCJ-UHFFFAOYSA-N.
| Molecular formula | C20H28B2O4S2 |
|---|---|
| Molecular weight | 418.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]thiophen-2-yl]-1,3,2-dioxaborolane |
| InChIKey | XWWXVHGWYCXJCJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)C3=CC=C(S3)B4OC(C(O4)(C)C)(C)C |
Computed by PubChem (NCBI)