cas: 239075-02-6 — see every product listed under this CAS number, including other names
5,5'-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,2'-bithiophene, 98%, 98% (CAS 239075-02-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114M9S-100mg |
| cas | 239075-02-6 |
| size | 100mg |
| availability | 44g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 429.20 Pln | |
| Chemat | 25g | 1350.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]thiophen-2-yl]-1,3,2-dioxaborolane (CAS 239075-02-6) is a chemical compound with the molecular formula C20H28B2O4S2 and a molecular weight of 418.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]thiophen-2-yl]-1,3,2-dioxaborolane. InChIKey: XWWXVHGWYCXJCJ-UHFFFAOYSA-N.
| Molecular formula | C20H28B2O4S2 |
|---|---|
| Molecular weight | 418.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]thiophen-2-yl]-1,3,2-dioxaborolane |
| InChIKey | XWWXVHGWYCXJCJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)C3=CC=C(S3)B4OC(C(O4)(C)C)(C)C |
Computed by PubChem (NCBI)