5,5'-Dimethyl-2,2'-bipyrimidine, 98%
cas: 935267-14-4 — see every product listed under this CAS number, including other names
5,5'-Dimethyl-2,2'-bipyrimidine, 98% (CAS 935267-14-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1705991-250mg |
| cas | 935267-14-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 631.81 Pln | |
| Ambeed | 5g | 2406.25 Pln | |
| BLDpharm | 250mg | 231.05 Pln | |
| BLDpharm | 1g | 619.81 Pln | |
| BLDpharm | 5g | 2363.64 Pln | |
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 5g | 2397.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
5-methyl-2-(5-methylpyrimidin-2-yl)pyrimidine (CAS 935267-14-4) is a chemical compound with the molecular formula C10H10N4 and a molecular weight of 186.21 g/mol. IUPAC name: 5-methyl-2-(5-methylpyrimidin-2-yl)pyrimidine. InChIKey: RXIDPALOABYPJL-UHFFFAOYSA-N.
| Molecular formula | C10H10N4 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 5-methyl-2-(5-methylpyrimidin-2-yl)pyrimidine |
| InChIKey | RXIDPALOABYPJL-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(N=C1)C2=NC=C(C=N2)C |
Computed by PubChem (NCBI)