Products 935267-14-4
CAS 935267-14-4 appears in our catalog under these names: 5,5'-Dimethyl-2,2'-bipyrimidine 98%, 5,5'-Dimethyl-2,2'-bipyrimidine, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-methyl-2-(5-methylpyrimidin-2-yl)pyrimidine (CAS 935267-14-4) is a chemical compound with the molecular formula C10H10N4 and a molecular weight of 186.21 g/mol. IUPAC name: 5-methyl-2-(5-methylpyrimidin-2-yl)pyrimidine. InChIKey: RXIDPALOABYPJL-UHFFFAOYSA-N.
| Molecular formula | C10H10N4 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 5-methyl-2-(5-methylpyrimidin-2-yl)pyrimidine |
| InChIKey | RXIDPALOABYPJL-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(N=C1)C2=NC=C(C=N2)C |
Computed by PubChem (NCBI)