cas: 929031-44-7 — see every product listed under this CAS number, including other names
5,6,7,8-TEtrahydronaphthalene-1-boronic acid pinacol ester, 95%, 95% (CAS 929031-44-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JVOS-100mg |
| cas | 929031-44-7 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 448.40 Pln | |
| Chemat | 250mg | 741.20 Pln | |
| Chemat | 1g | 2267.60 Pln | |
| Chemat | 5g | 6798.80 Pln | |
| Chemat | 10g | 10398.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,3,2-dioxaborolane (CAS 929031-44-7) is a chemical compound with the molecular formula C16H23BO2 and a molecular weight of 258.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,3,2-dioxaborolane. InChIKey: ZEQMAKMHBSNXHC-UHFFFAOYSA-N.
| Molecular formula | C16H23BO2 |
|---|---|
| Molecular weight | 258.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,3,2-dioxaborolane |
| InChIKey | ZEQMAKMHBSNXHC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3CCCCC3=CC=C2 |
Computed by PubChem (NCBI)